C25H22F6N4O4S — CID 22053555
6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methoxyphenyl)-2-methylsulfonyl-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one (PubChem CID 22053555) has the molecular formula C25H22F6N4O4S and a molecular weight of 588.53 g/mol. Its IUPAC name is 6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methoxyphenyl)-2-methylsulfonyl-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one.
| Compound Name | 6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methoxyphenyl)-2-methylsulfonyl-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one |
|---|---|
| PubChem CID | 22053555 |
| Molecular Formula | C25H22F6N4O4S |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2-methoxyphenyl)-2-methylsulfonyl-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one |
| SMILES | COc1ccccc1-c1nc(S(C)(=O)=O)nc2c1C(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCCN2 |
| InChI | InChI=1S/C25H22F6N4O4S/c1-39-18-7-4-3-6-17(18)20-19-21(34-23(33-20)40(2,37)38)32-8-5-9-35(22(19)36)13-14-10-15(24(26,27)28)12-16(11-14)25(29,30)31/h3-4,6-7,10-12H,5,8-9,13H2,1-2H3,(H,32,33,34) |
| InChIKey | YEDPXUKNAIQWQK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |