C23H24FN3O3 — CID 22061021
4-N-(4-butoxyphenyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyridine-2,4-diamine (PubChem CID 22061021) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyridine-2,4-diamine.
| Compound Name | 4-N-(4-butoxyphenyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyridine-2,4-diamine |
|---|---|
| PubChem CID | 22061021 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyridine-2,4-diamine |
| SMILES | CCCCOc1ccc(Nc2cc(Nc3ccc4c(c3)OCCO4)ncc2F)cc1 |
| InChI | InChI=1S/C23H24FN3O3/c1-2-3-10-28-18-7-4-16(5-8-18)26-20-14-23(25-15-19(20)24)27-17-6-9-21-22(13-17)30-12-11-29-21/h4-9,13-15H,2-3,10-12H2,1H3,(H2,25,26,27) |
| InChIKey | JGZJJOWLFBHIDK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|