About 3-sulfonylindazole
3-sulfonylindazole (PubChem CID 22065950) has the molecular formula C7H4N2O2S
and a molecular weight of 180.19 g/mol. Its IUPAC name is 3-sulfonylindazole.
Molecular Properties
| Compound Name | 3-sulfonylindazole |
| PubChem CID | 22065950 |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 3-sulfonylindazole |
| SMILES | O=S(=O)=C1N=Nc2ccccc21 |
| InChI | InChI=1S/C7H4N2O2S/c10-12(11)7-5-3-1-2-4-6(5)8-9-7/h1-4H |
| InChIKey | DDJYYJIWIYUTRV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfonylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfonylindazole?
The IUPAC name of 3-sulfonylindazole (CID 22065950) is 3-sulfonylindazole.
What is the SMILES notation for 3-sulfonylindazole?
The canonical SMILES for 3-sulfonylindazole is O=S(=O)=C1N=Nc2ccccc21.
What is the InChIKey of 3-sulfonylindazole?
The InChIKey is DDJYYJIWIYUTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2S/c10-12(11)7-5-3-1-2-4-6(5)8-9-7/h1-4H.
What are the key properties of 3-sulfonylindazole?
3-sulfonylindazole has a molecular weight of 180.19 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfonylindazole is sourced from PubChem (CID 22065950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).