C26H34N2O7S — CID 22069231
tert-butyl 4-[2-[benzyl-(4-methoxyphenyl)sulfonylamino]oxy-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 22069231) has the molecular formula C26H34N2O7S and a molecular weight of 518.63 g/mol. Its IUPAC name is tert-butyl 4-[2-[benzyl-(4-methoxyphenyl)sulfonylamino]oxy-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[benzyl-(4-methoxyphenyl)sulfonylamino]oxy-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22069231 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | tert-butyl 4-[2-[benzyl-(4-methoxyphenyl)sulfonylamino]oxy-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)OC(=O)CC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O7S/c1-26(2,3)34-25(30)27-16-14-20(15-17-27)18-24(29)35-28(19-21-8-6-5-7-9-21)36(31,32)23-12-10-22(33-4)11-13-23/h5-13,20H,14-19H2,1-4H3 |
| InChIKey | FVWMHPMSDKTRSK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|