C18H22N2O3S — CID 22077384
2-[4-[2-(2-piperidin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]acetic acid (PubChem CID 22077384) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[4-[2-(2-piperidin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-(2-piperidin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 22077384 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[4-[2-(2-piperidin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2csc(CCC3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c21-18(22)11-23-15-4-2-14(3-5-15)16-12-24-17(20-16)6-1-13-7-9-19-10-8-13/h2-5,12-13,19H,1,6-11H2,(H,21,22) |
| InChIKey | QUXLISBXVTYHNU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |