C15H27N5O4 — CID 22084249
3-(diaminomethylideneamino)-4-[2-(diethylamino)-1-(methoxymethylideneamino)-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 22084249) has the molecular formula C15H27N5O4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-4-[2-(diethylamino)-1-(methoxymethylideneamino)-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3-(diaminomethylideneamino)-4-[2-(diethylamino)-1-(methoxymethylideneamino)-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 22084249 |
| Molecular Formula | C15H27N5O4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3-(diaminomethylideneamino)-4-[2-(diethylamino)-1-(methoxymethylideneamino)-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | CCN(CC)C(=O)C(/N=C/OC)C1CC(C(=O)O)CC1N=C(N)N |
| InChI | InChI=1S/C15H27N5O4/c1-4-20(5-2)13(21)12(18-8-24-3)10-6-9(14(22)23)7-11(10)19-15(16)17/h8-12H,4-7H2,1-3H3,(H,22,23)(H4,16,17,19)/b18-8+ |
| InChIKey | NMRWRWNULBSODG-QGMBQPNBSA-N |
| XLogP | -0.35 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|