C23H40N2O8S3 — CID 22084267
diethyl 2-acetamido-2-[4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[tris(methylsulfanyl)methyl]cyclopentyl]propanedioate (PubChem CID 22084267) has the molecular formula C23H40N2O8S3 and a molecular weight of 568.78 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[tris(methylsulfanyl)methyl]cyclopentyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[tris(methylsulfanyl)methyl]cyclopentyl]propanedioate |
|---|---|
| PubChem CID | 22084267 |
| Molecular Formula | C23H40N2O8S3 |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | diethyl 2-acetamido-2-[4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[tris(methylsulfanyl)methyl]cyclopentyl]propanedioate |
| SMILES | CCOC(=O)C(NC(C)=O)(C(=O)OCC)C1CC(O)(C(SC)(SC)SC)CC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H40N2O8S3/c1-10-31-17(27)22(25-14(3)26,18(28)32-11-2)15-12-21(30,23(34-7,35-8)36-9)13-16(15)24-19(29)33-20(4,5)6/h15-16,30H,10-13H2,1-9H3,(H,24,29)(H,25,26) |
| InChIKey | GJSCSIDKAOMXJL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|