C14H20N4O6 — CID 10958749
diethyl 2-acetamido-2-[(1R,2R)-2-azido-4-oxocyclopentyl]propanedioate (PubChem CID 10958749) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(1R,2R)-2-azido-4-oxocyclopentyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(1R,2R)-2-azido-4-oxocyclopentyl]propanedioate |
|---|---|
| PubChem CID | 10958749 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | diethyl 2-acetamido-2-[(1R,2R)-2-azido-4-oxocyclopentyl]propanedioate |
| SMILES | CCOC(=O)C(NC(C)=O)(C(=O)OCC)[C@@H]1CC(=O)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H20N4O6/c1-4-23-12(21)14(16-8(3)19,13(22)24-5-2)10-6-9(20)7-11(10)17-18-15/h10-11H,4-7H2,1-3H3,(H,16,19)/t10-,11-/m1/s1 |
| InChIKey | QYOKZSWWPMISOX-GHMZBOCLSA-N |
| XLogP | 0.65 |
| TPSA | 147.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|