C11H16N8O4 — CID 22086580
2-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]guanidine (PubChem CID 22086580) has the molecular formula C11H16N8O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]guanidine.
| Compound Name | 2-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]guanidine |
|---|---|
| PubChem CID | 22086580 |
| Molecular Formula | C11H16N8O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C11H16N8O4/c12-7-4-8(17-11(16-7)18-10(13)14)19(2-15-4)9-6(22)5(21)3(1-20)23-9/h2-3,5-6,9,20-22H,1H2,(H6,12,13,14,16,17,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | ZUPHRAHMNCYMQO-UUOKFMHZSA-N |
| XLogP | -3.08 |
| TPSA | 203.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|