C15H23N7O4 — CID 91127144
(4S)-2-[6-amino-2-(3-methylbutyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 91127144) has the molecular formula C15H23N7O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (4S)-2-[6-amino-2-(3-methylbutyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (4S)-2-[6-amino-2-(3-methylbutyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91127144 |
| Molecular Formula | C15H23N7O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (4S)-2-[6-amino-2-(3-methylbutyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)CC/N=N/c1nc(N)c2ncn(C3OC(CO)[C@@H](O)C3O)c2n1 |
| InChI | InChI=1S/C15H23N7O4/c1-7(2)3-4-18-21-15-19-12(16)9-13(20-15)22(6-17-9)14-11(25)10(24)8(5-23)26-14/h6-8,10-11,14,23-25H,3-5H2,1-2H3,(H2,16,19,20)/b21-18+/t8?,10-,11?,14?/m1/s1 |
| InChIKey | ZTVSTYGPZYYXLB-VUGXSQPOSA-N |
| XLogP | 0.15 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|