C20H27N7O4 — CID 91900171
(3R,4S,5R)-2-[6-amino-2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyldiazenyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 91900171) has the molecular formula C20H27N7O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-amino-2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyldiazenyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-amino-2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyldiazenyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91900171 |
| Molecular Formula | C20H27N7O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (3R,4S,5R)-2-[6-amino-2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyldiazenyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC1(C)C2CC=C(C/N=N/c3nc(N)c4ncn(C5O[C@H](CO)[C@@H](O)[C@H]5O)c4n3)C1C2 |
| InChI | InChI=1S/C20H27N7O4/c1-20(2)10-4-3-9(11(20)5-10)6-23-26-19-24-16(21)13-17(25-19)27(8-22-13)18-15(30)14(29)12(7-28)31-18/h3,8,10-12,14-15,18,28-30H,4-7H2,1-2H3,(H2,21,24,25)/b26-23+/t10?,11?,12-,14-,15-,18?/m1/s1 |
| InChIKey | PDFWLNLFGLAMJG-XCLCNADCSA-N |
| XLogP | 1.10 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|