C15H17N7O4S — CID 57318429
(2R,5R)-2-[6-amino-2-(thiophen-2-ylmethyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57318429) has the molecular formula C15H17N7O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-2-(thiophen-2-ylmethyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-2-(thiophen-2-ylmethyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57318429 |
| Molecular Formula | C15H17N7O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2R,5R)-2-[6-amino-2-(thiophen-2-ylmethyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(/N=N/Cc2cccs2)nc2c1ncn2[C@@H]1O[C@H](CO)C(O)C1O |
| InChI | InChI=1S/C15H17N7O4S/c16-12-9-13(20-15(19-12)21-18-4-7-2-1-3-27-7)22(6-17-9)14-11(25)10(24)8(5-23)26-14/h1-3,6,8,10-11,14,23-25H,4-5H2,(H2,16,19,20)/b21-18+/t8-,10?,11?,14-/m1/s1 |
| InChIKey | RPKOJAVNWMOJKC-QMCFAMECSA-N |
| XLogP | 0.37 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|