C16H25N7O4 — CID 91181777
(2R,5R)-2-[6-amino-2-(4-methylpentyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 91181777) has the molecular formula C16H25N7O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-2-(4-methylpentyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-2-(4-methylpentyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91181777 |
| Molecular Formula | C16H25N7O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (2R,5R)-2-[6-amino-2-(4-methylpentyldiazenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)CCC/N=N/c1nc(N)c2ncn([C@@H]3O[C@H](CO)C(O)C3O)c2n1 |
| InChI | InChI=1S/C16H25N7O4/c1-8(2)4-3-5-19-22-16-20-13(17)10-14(21-16)23(7-18-10)15-12(26)11(25)9(6-24)27-15/h7-9,11-12,15,24-26H,3-6H2,1-2H3,(H2,17,20,21)/b22-19+/t9-,11?,12?,15-/m1/s1 |
| InChIKey | ZCVCOFVERSUEOS-OTTYIBHWSA-N |
| XLogP | 0.54 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|