C15H14N2O5 — CID 22088172
5-[[4-(hydroperoxymethyl)phenyl]diazenyl]-2-(hydroxymethyl)benzoic acid (PubChem CID 22088172) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 5-[[4-(hydroperoxymethyl)phenyl]diazenyl]-2-(hydroxymethyl)benzoic acid.
| Compound Name | 5-[[4-(hydroperoxymethyl)phenyl]diazenyl]-2-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 22088172 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[[4-(hydroperoxymethyl)phenyl]diazenyl]-2-(hydroxymethyl)benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(COO)cc2)ccc1CO |
| InChI | InChI=1S/C15H14N2O5/c18-8-11-3-6-13(7-14(11)15(19)20)17-16-12-4-1-10(2-5-12)9-22-21/h1-7,18,21H,8-9H2,(H,19,20)/b17-16+ |
| InChIKey | HBWPQKKXMBIFAJ-WUKNDPDISA-N |
| XLogP | 3.28 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|