About thieno[3,2-b]furan-6-ol
thieno[3,2-b]furan-6-ol (PubChem CID 22090606) has the molecular formula C6H4O2S
and a molecular weight of 140.16 g/mol. Its IUPAC name is thieno[3,2-b]furan-6-ol.
Molecular Properties
| Compound Name | thieno[3,2-b]furan-6-ol |
| PubChem CID | 22090606 |
| Molecular Formula | C6H4O2S |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 139.99 |
| IUPAC Name | thieno[3,2-b]furan-6-ol |
| SMILES | Oc1csc2ccoc12 |
| InChI | InChI=1S/C6H4O2S/c7-4-3-9-5-1-2-8-6(4)5/h1-3,7H |
| InChIKey | LLCVZNPAUGUVIA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,2-b]furan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]furan-6-ol?
The IUPAC name of thieno[3,2-b]furan-6-ol (CID 22090606) is thieno[3,2-b]furan-6-ol.
What is the SMILES notation for thieno[3,2-b]furan-6-ol?
The canonical SMILES for thieno[3,2-b]furan-6-ol is Oc1csc2ccoc12.
What is the InChIKey of thieno[3,2-b]furan-6-ol?
The InChIKey is LLCVZNPAUGUVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2S/c7-4-3-9-5-1-2-8-6(4)5/h1-3,7H.
What are the key properties of thieno[3,2-b]furan-6-ol?
thieno[3,2-b]furan-6-ol has a molecular weight of 140.16 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]furan-6-ol is sourced from PubChem (CID 22090606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).