C20H21BrN4O2S2 — CID 2210200
ethyl 2-[3-(4-bromopyrazol-1-yl)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 2210200) has the molecular formula C20H21BrN4O2S2 and a molecular weight of 493.45 g/mol. Its IUPAC name is ethyl 2-[3-(4-bromopyrazol-1-yl)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-bromopyrazol-1-yl)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2210200 |
| Molecular Formula | C20H21BrN4O2S2 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | ethyl 2-[3-(4-bromopyrazol-1-yl)propylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)NCCCn1cc(Br)cn1 |
| InChI | InChI=1S/C20H21BrN4O2S2/c1-2-27-19(26)16-11-17(14-7-4-3-5-8-14)29-18(16)24-20(28)22-9-6-10-25-13-15(21)12-23-25/h3-5,7-8,11-13H,2,6,9-10H2,1H3,(H2,22,24,28) |
| InChIKey | KSUFYMNBPDSXCH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|