C20H22N2O12S2 — CID 22111706
propan-2-yl 2,5-bis[(2-nitrophenyl)sulfonyloxy]pentanoate (PubChem CID 22111706) has the molecular formula C20H22N2O12S2 and a molecular weight of 546.53 g/mol. Its IUPAC name is propan-2-yl 2,5-bis[(2-nitrophenyl)sulfonyloxy]pentanoate.
| Compound Name | propan-2-yl 2,5-bis[(2-nitrophenyl)sulfonyloxy]pentanoate |
|---|---|
| PubChem CID | 22111706 |
| Molecular Formula | C20H22N2O12S2 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | propan-2-yl 2,5-bis[(2-nitrophenyl)sulfonyloxy]pentanoate |
| SMILES | CC(C)OC(=O)C(CCCOS(=O)(=O)c1ccccc1[N+](=O)[O-])OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N2O12S2/c1-14(2)33-20(23)17(34-36(30,31)19-12-6-4-9-16(19)22(26)27)10-7-13-32-35(28,29)18-11-5-3-8-15(18)21(24)25/h3-6,8-9,11-12,14,17H,7,10,13H2,1-2H3 |
| InChIKey | IXDAIWBPDJYCSR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 199.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|