C16H17ClN2O4S — CID 22118441
(2-ethylpyrazol-3-yl) 4-chloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate (PubChem CID 22118441) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl) 4-chloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate.
| Compound Name | (2-ethylpyrazol-3-yl) 4-chloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate |
|---|---|
| PubChem CID | 22118441 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (2-ethylpyrazol-3-yl) 4-chloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate |
| SMILES | CCn1nccc1OC(=O)c1ccc2c(c1C)C(Cl)CCS2(=O)=O |
| InChI | InChI=1S/C16H17ClN2O4S/c1-3-19-14(6-8-18-19)23-16(20)11-4-5-13-15(10(11)2)12(17)7-9-24(13,21)22/h4-6,8,12H,3,7,9H2,1-2H3 |
| InChIKey | DYAVJCDUCLWQFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|