C18H20Cl2N4O2 — CID 22123188
N-amino-3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzenecarboximidamide (PubChem CID 22123188) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is N-amino-3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzenecarboximidamide.
| Compound Name | N-amino-3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 22123188 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-amino-3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\c1ccc(OC)c(OC2CCCC2)c1)N(N)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C18H20Cl2N4O2/c1-25-15-7-6-11(8-16(15)26-12-4-2-3-5-12)18(21)24(22)17-13(19)9-23-10-14(17)20/h6-10,12,21H,2-5,22H2,1H3/b21-18+ |
| InChIKey | BPYIXKONQAVIRF-DYTRJAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|