About 2-ethylsulfonylimidazo[1,2-a]pyridine
2-ethylsulfonylimidazo[1,2-a]pyridine (PubChem CID 22124225) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-ethylsulfonylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-ethylsulfonylimidazo[1,2-a]pyridine |
| PubChem CID | 22124225 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-ethylsulfonylimidazo[1,2-a]pyridine |
| SMILES | CCS(=O)(=O)c1cn2ccccc2n1 |
| InChI | InChI=1S/C9H10N2O2S/c1-2-14(12,13)9-7-11-6-4-3-5-8(11)10-9/h3-7H,2H2,1H3 |
| InChIKey | ZTIKVZNZADOZOA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylsulfonylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonylimidazo[1,2-a]pyridine?
The IUPAC name of 2-ethylsulfonylimidazo[1,2-a]pyridine (CID 22124225) is 2-ethylsulfonylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-ethylsulfonylimidazo[1,2-a]pyridine?
The canonical SMILES for 2-ethylsulfonylimidazo[1,2-a]pyridine is CCS(=O)(=O)c1cn2ccccc2n1.
What is the InChIKey of 2-ethylsulfonylimidazo[1,2-a]pyridine?
The InChIKey is ZTIKVZNZADOZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-2-14(12,13)9-7-11-6-4-3-5-8(11)10-9/h3-7H,2H2,1H3.
What are the key properties of 2-ethylsulfonylimidazo[1,2-a]pyridine?
2-ethylsulfonylimidazo[1,2-a]pyridine has a molecular weight of 210.26 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonylimidazo[1,2-a]pyridine is sourced from PubChem (CID 22124225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).