C27H32N4O4 — CID 22135093
tert-butyl 4-[[2-[N-(1H-indole-6-carbonyl)anilino]acetyl]amino]piperidine-1-carboxylate (PubChem CID 22135093) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is tert-butyl 4-[[2-[N-(1H-indole-6-carbonyl)anilino]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[N-(1H-indole-6-carbonyl)anilino]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22135093 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | tert-butyl 4-[[2-[N-(1H-indole-6-carbonyl)anilino]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)CN(C(=O)c2ccc3cc[nH]c3c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O4/c1-27(2,3)35-26(34)30-15-12-21(13-16-30)29-24(32)18-31(22-7-5-4-6-8-22)25(33)20-10-9-19-11-14-28-23(19)17-20/h4-11,14,17,21,28H,12-13,15-16,18H2,1-3H3,(H,29,32) |
| InChIKey | CMMRNQOKCJXEDM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |