C27H54N6O6 — CID 22138288
2-N,2-N,4-N,4-N,6-N,6-N-hexabutoxy-1,3,5-triazine-2,4,6-triamine (PubChem CID 22138288) has the molecular formula C27H54N6O6 and a molecular weight of 558.77 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexabutoxy-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexabutoxy-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 22138288 |
| Molecular Formula | C27H54N6O6 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.41 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexabutoxy-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCON(OCCCC)c1nc(N(OCCCC)OCCCC)nc(N(OCCCC)OCCCC)n1 |
| InChI | InChI=1S/C27H54N6O6/c1-7-13-19-34-31(35-20-14-8-2)25-28-26(32(36-21-15-9-3)37-22-16-10-4)30-27(29-25)33(38-23-17-11-5)39-24-18-12-6/h7-24H2,1-6H3 |
| InChIKey | HUMGQBDCYUVBIR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 103.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|