C8H13F3O4S — CID 22144022
4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoic acid (PubChem CID 22144022) has the molecular formula C8H13F3O4S and a molecular weight of 262.25 g/mol. Its IUPAC name is 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoic acid.
| Compound Name | 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 22144022 |
| Molecular Formula | C8H13F3O4S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoic acid |
| SMILES | CC(C)CC(CS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H13F3O4S/c1-5(2)3-6(7(12)13)4-16(14,15)8(9,10)11/h5-6H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | YNHZBBCWWUVBPZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |