C33H36N3O7+ — CID 22158914
5-O-(2-aminoethyl) 3-O-methyl 1-(3,3-diphenylpropyl)-1-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-ium-3,5-dicarboxylate (PubChem CID 22158914) has the molecular formula C33H36N3O7+ and a molecular weight of 586.67 g/mol. Its IUPAC name is 5-O-(2-aminoethyl) 3-O-methyl 1-(3,3-diphenylpropyl)-1-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-ium-3,5-dicarboxylate.
| Compound Name | 5-O-(2-aminoethyl) 3-O-methyl 1-(3,3-diphenylpropyl)-1-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-ium-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22158914 |
| Molecular Formula | C33H36N3O7+ |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 5-O-(2-aminoethyl) 3-O-methyl 1-(3,3-diphenylpropyl)-1-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-ium-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)[N+](O)(CCC(c2ccccc2)c2ccccc2)C(C)=C(C(=O)OCCN)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H36N3O7/c1-22-29(32(37)42-3)31(26-15-10-16-27(21-26)35(39)40)30(33(38)43-20-18-34)23(2)36(22,41)19-17-28(24-11-6-4-7-12-24)25-13-8-5-9-14-25/h4-16,21,28,31,41H,17-20,34H2,1-3H3/q+1 |
| InChIKey | LJDCRCKWXDEMRR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|