C18H22NO2+ — CID 22166041
2-benzyl-2-propan-2-yl-1,3-dihydroisoindol-2-ium-5,6-diol (PubChem CID 22166041) has the molecular formula C18H22NO2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-benzyl-2-propan-2-yl-1,3-dihydroisoindol-2-ium-5,6-diol.
| Compound Name | 2-benzyl-2-propan-2-yl-1,3-dihydroisoindol-2-ium-5,6-diol |
|---|---|
| PubChem CID | 22166041 |
| Molecular Formula | C18H22NO2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-benzyl-2-propan-2-yl-1,3-dihydroisoindol-2-ium-5,6-diol |
| SMILES | CC(C)[N+]1(Cc2ccccc2)Cc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C18H21NO2/c1-13(2)19(10-14-6-4-3-5-7-14)11-15-8-17(20)18(21)9-16(15)12-19/h3-9,13H,10-12H2,1-2H3,(H-,20,21)/p+1 |
| InChIKey | DZRUBWTXDWVBDE-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|