C23H29Cl2NO6 — CID 22175182
tert-butyl 4-butoxy-6,7-dichloro-2-(3-ethoxy-3-oxopropyl)-1-oxoisoquinoline-3-carboxylate (PubChem CID 22175182) has the molecular formula C23H29Cl2NO6 and a molecular weight of 486.39 g/mol. Its IUPAC name is tert-butyl 4-butoxy-6,7-dichloro-2-(3-ethoxy-3-oxopropyl)-1-oxoisoquinoline-3-carboxylate.
| Compound Name | tert-butyl 4-butoxy-6,7-dichloro-2-(3-ethoxy-3-oxopropyl)-1-oxoisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 22175182 |
| Molecular Formula | C23H29Cl2NO6 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | tert-butyl 4-butoxy-6,7-dichloro-2-(3-ethoxy-3-oxopropyl)-1-oxoisoquinoline-3-carboxylate |
| SMILES | CCCCOc1c(C(=O)OC(C)(C)C)n(CCC(=O)OCC)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C23H29Cl2NO6/c1-6-8-11-31-20-14-12-16(24)17(25)13-15(14)21(28)26(10-9-18(27)30-7-2)19(20)22(29)32-23(3,4)5/h12-13H,6-11H2,1-5H3 |
| InChIKey | PAQAKKQCHFEUTQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|