C20H14N2O2 — CID 2217758
4-[(Z)-1-cyano-2-(5-methoxy-2-prop-2-ynoxyphenyl)ethenyl]benzonitrile (PubChem CID 2217758) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[(Z)-1-cyano-2-(5-methoxy-2-prop-2-ynoxyphenyl)ethenyl]benzonitrile.
| Compound Name | 4-[(Z)-1-cyano-2-(5-methoxy-2-prop-2-ynoxyphenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 2217758 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-[(Z)-1-cyano-2-(5-methoxy-2-prop-2-ynoxyphenyl)ethenyl]benzonitrile |
| SMILES | C#CCOc1ccc(OC)cc1/C=C(\C#N)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H14N2O2/c1-3-10-24-20-9-8-19(23-2)12-17(20)11-18(14-22)16-6-4-15(13-21)5-7-16/h1,4-9,11-12H,10H2,2H3/b18-11+ |
| InChIKey | MISRPRBNVXBJPE-WOJGMQOQSA-N |
| XLogP | 3.64 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|