C35H43Cl2N3O — CID 22180235
3-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-N-cyclohexyl-N-propan-2-ylbenzamide (PubChem CID 22180235) has the molecular formula C35H43Cl2N3O and a molecular weight of 592.66 g/mol. Its IUPAC name is 3-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-N-cyclohexyl-N-propan-2-ylbenzamide.
| Compound Name | 3-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-N-cyclohexyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 22180235 |
| Molecular Formula | C35H43Cl2N3O |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | 3-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-N-cyclohexyl-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1cccc(N2CCN(CCC(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C35H43Cl2N3O/c1-26(2)40(32-8-4-3-5-9-32)35(41)29-7-6-10-33(25-29)39-23-21-38(22-24-39)20-19-34(27-11-15-30(36)16-12-27)28-13-17-31(37)18-14-28/h6-7,10-18,25-26,32,34H,3-5,8-9,19-24H2,1-2H3 |
| InChIKey | DBJDOGAUERYLLZ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |