C14H11N2O2S2- — CID 2218568
benzenesulfonyl-(4-methyl-1,3-benzothiazol-2-yl)azanide (PubChem CID 2218568) has the molecular formula C14H11N2O2S2- and a molecular weight of 303.39 g/mol. Its IUPAC name is benzenesulfonyl-(4-methyl-1,3-benzothiazol-2-yl)azanide.
| Compound Name | benzenesulfonyl-(4-methyl-1,3-benzothiazol-2-yl)azanide |
|---|---|
| PubChem CID | 2218568 |
| Molecular Formula | C14H11N2O2S2- |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | benzenesulfonyl-(4-methyl-1,3-benzothiazol-2-yl)azanide |
| SMILES | Cc1cccc2sc([N-]S(=O)(=O)c3ccccc3)nc12 |
| InChI | InChI=1S/C14H11N2O2S2/c1-10-6-5-9-12-13(10)15-14(19-12)16-20(17,18)11-7-3-2-4-8-11/h2-9H,1H3/q-1 |
| InChIKey | KJOKZLWUTHMTPG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |