C23H14ClFNO3- — CID 2219147
3-[[2-chloro-4-[(Z)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]methyl]benzoate (PubChem CID 2219147) has the molecular formula C23H14ClFNO3- and a molecular weight of 406.82 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(Z)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]methyl]benzoate.
| Compound Name | 3-[[2-chloro-4-[(Z)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 2219147 |
| Molecular Formula | C23H14ClFNO3- |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-[[2-chloro-4-[(Z)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]methyl]benzoate |
| SMILES | N#C/C(=C\c1ccc(OCc2cccc(C(=O)[O-])c2)c(Cl)c1)c1ccccc1F |
| InChI | InChI=1S/C23H15ClFNO3/c24-20-12-15(10-18(13-26)19-6-1-2-7-21(19)25)8-9-22(20)29-14-16-4-3-5-17(11-16)23(27)28/h1-12H,14H2,(H,27,28)/p-1/b18-10+ |
| InChIKey | HNGFLRBLADBHBJ-VCHYOVAHSA-M |
| XLogP | 4.49 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|