C19H24ClFNO2+ — CID 2219244
[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-(3-ethoxypropyl)azanium (PubChem CID 2219244) has the molecular formula C19H24ClFNO2+ and a molecular weight of 352.86 g/mol. Its IUPAC name is [5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-(3-ethoxypropyl)azanium.
| Compound Name | [5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-(3-ethoxypropyl)azanium |
|---|---|
| PubChem CID | 2219244 |
| Molecular Formula | C19H24ClFNO2+ |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-(3-ethoxypropyl)azanium |
| SMILES | CCOCCC[NH2+]Cc1cc(Cl)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23ClFNO2/c1-2-23-11-3-10-22-13-16-12-17(20)6-9-19(16)24-14-15-4-7-18(21)8-5-15/h4-9,12,22H,2-3,10-11,13-14H2,1H3/p+1 |
| InChIKey | VSSAKZJKKCFDEN-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|