C22H28ClFNO+ — CID 8620818
[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-cyclooctylazanium (PubChem CID 8620818) has the molecular formula C22H28ClFNO+ and a molecular weight of 376.92 g/mol. Its IUPAC name is [5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-cyclooctylazanium.
| Compound Name | [5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-cyclooctylazanium |
|---|---|
| PubChem CID | 8620818 |
| Molecular Formula | C22H28ClFNO+ |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl-cyclooctylazanium |
| SMILES | Fc1ccc(COc2ccc(Cl)cc2C[NH2+]C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C22H27ClFNO/c23-19-10-13-22(26-16-17-8-11-20(24)12-9-17)18(14-19)15-25-21-6-4-2-1-3-5-7-21/h8-14,21,25H,1-7,15-16H2/p+1 |
| InChIKey | QMRRUTFTOFJIQP-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |