C23H22N2O3S — CID 22199973
methyl 2-[[2-(2-methyl-2,3-dihydroindol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 22199973) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is methyl 2-[[2-(2-methyl-2,3-dihydroindol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(2-methyl-2,3-dihydroindol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 22199973 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | methyl 2-[[2-(2-methyl-2,3-dihydroindol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)csc1NC(=O)CN1c2ccccc2CC1C |
| InChI | InChI=1S/C23H22N2O3S/c1-15-12-17-10-6-7-11-19(17)25(15)13-20(26)24-22-21(23(27)28-2)18(14-29-22)16-8-4-3-5-9-16/h3-11,14-15H,12-13H2,1-2H3,(H,24,26) |
| InChIKey | MXZDIRAHVSRXBK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|