C24H24N6O6S — CID 22216268
[4-[4-hydrazinyl-4-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]sulfonyl-1-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]hydrazine (PubChem CID 22216268) has the molecular formula C24H24N6O6S and a molecular weight of 524.56 g/mol. Its IUPAC name is [4-[4-hydrazinyl-4-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]sulfonyl-1-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]hydrazine.
| Compound Name | [4-[4-hydrazinyl-4-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]sulfonyl-1-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]hydrazine |
|---|---|
| PubChem CID | 22216268 |
| Molecular Formula | C24H24N6O6S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [4-[4-hydrazinyl-4-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]sulfonyl-1-(2-nitrophenyl)cyclohexa-2,5-dien-1-yl]hydrazine |
| SMILES | NNC1(c2ccccc2[N+](=O)[O-])C=CC(S(=O)(=O)C2C=CC(NN)(c3ccccc3[N+](=O)[O-])C=C2)C=C1 |
| InChI | InChI=1S/C24H24N6O6S/c25-27-23(19-5-1-3-7-21(19)29(31)32)13-9-17(10-14-23)37(35,36)18-11-15-24(28-26,16-12-18)20-6-2-4-8-22(20)30(33)34/h1-18,27-28H,25-26H2 |
| InChIKey | QKRBQPWYQWFUNL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|