C25H41FN2O6Si — CID 22219869
4-O-tert-butyl 1-O-[[3-(2-trimethylsilylethoxymethoxy)phenyl]methyl] 2-fluoro-2,6-dimethylpiperazine-1,4-dicarboxylate (PubChem CID 22219869) has the molecular formula C25H41FN2O6Si and a molecular weight of 512.70 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[[3-(2-trimethylsilylethoxymethoxy)phenyl]methyl] 2-fluoro-2,6-dimethylpiperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-[[3-(2-trimethylsilylethoxymethoxy)phenyl]methyl] 2-fluoro-2,6-dimethylpiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22219869 |
| Molecular Formula | C25H41FN2O6Si |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 4-O-tert-butyl 1-O-[[3-(2-trimethylsilylethoxymethoxy)phenyl]methyl] 2-fluoro-2,6-dimethylpiperazine-1,4-dicarboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC(C)(F)N1C(=O)OCc1cccc(OCOCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C25H41FN2O6Si/c1-19-15-27(22(29)34-24(2,3)4)17-25(5,26)28(19)23(30)32-16-20-10-9-11-21(14-20)33-18-31-12-13-35(6,7)8/h9-11,14,19H,12-13,15-18H2,1-8H3 |
| InChIKey | QCWDXLKHSJXLAX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|