C18H27NO7 — CID 22233049
2-ethoxy-3-hydroxy-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22233049) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-ethoxy-3-hydroxy-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-hydroxy-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233049 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-ethoxy-3-hydroxy-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(C(=O)O)C(O)c1ccc(OCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO7/c1-5-24-15(16(21)22)14(20)12-6-8-13(9-7-12)25-11-10-19-17(23)26-18(2,3)4/h6-9,14-15,20H,5,10-11H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | NLDLRZJWWXKUTO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|