C16H12N2O2 — CID 22245976
cyclohexa-2,5-diene-1,4-dione;4H-pyrrolo[1,2-a]benzimidazole (PubChem CID 22245976) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;4H-pyrrolo[1,2-a]benzimidazole.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;4H-pyrrolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 22245976 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;4H-pyrrolo[1,2-a]benzimidazole |
| SMILES | O=C1C=CC(=O)C=C1.c1ccc2c(c1)[nH]c1cccn12 |
| InChI | InChI=1S/C10H8N2.C6H4O2/c1-2-5-9-8(4-1)11-10-6-3-7-12(9)10;7-5-1-2-6(8)4-3-5/h1-7,11H;1-4H |
| InChIKey | PWIKPGCNJWHHLE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|