C7H11F3O2 — CID 22247113
3-methyl-3-(1,2,2-trifluoroethoxymethyl)oxetane (PubChem CID 22247113) has the molecular formula C7H11F3O2 and a molecular weight of 184.16 g/mol. Its IUPAC name is 3-methyl-3-(1,2,2-trifluoroethoxymethyl)oxetane.
| Compound Name | 3-methyl-3-(1,2,2-trifluoroethoxymethyl)oxetane |
|---|---|
| PubChem CID | 22247113 |
| Molecular Formula | C7H11F3O2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-methyl-3-(1,2,2-trifluoroethoxymethyl)oxetane |
| SMILES | CC1(COC(F)C(F)F)COC1 |
| InChI | InChI=1S/C7H11F3O2/c1-7(2-11-3-7)4-12-6(10)5(8)9/h5-6H,2-4H2,1H3 |
| InChIKey | VDJHQMSKDQCYGJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |