C25H31BrN4O — CID 22249733
4-bromo-7,11-dimethyl-3-(3-propan-2-yloxypropyl)-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22249733) has the molecular formula C25H31BrN4O and a molecular weight of 483.45 g/mol. Its IUPAC name is 4-bromo-7,11-dimethyl-3-(3-propan-2-yloxypropyl)-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 4-bromo-7,11-dimethyl-3-(3-propan-2-yloxypropyl)-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22249733 |
| Molecular Formula | C25H31BrN4O |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4-bromo-7,11-dimethyl-3-(3-propan-2-yloxypropyl)-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | Cc1cc(C)c(-c2c(C)nn3c2nc(C)c2cc(Br)n(CCCOC(C)C)c23)c(C)c1 |
| InChI | InChI=1S/C25H31BrN4O/c1-14(2)31-10-8-9-29-21(26)13-20-18(6)27-24-23(19(7)28-30(24)25(20)29)22-16(4)11-15(3)12-17(22)5/h11-14H,8-10H2,1-7H3 |
| InChIKey | OWJXDBHZLYCPNX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|