C29H28N4 — CID 22250015
3-benzyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22250015) has the molecular formula C29H28N4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-benzyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-benzyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22250015 |
| Molecular Formula | C29H28N4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 3-benzyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CC#Cc1cc2c(C)nc3c(-c4c(C)cc(C)cc4C)c(C)nn3c2n1Cc1ccccc1 |
| InChI | InChI=1S/C29H28N4/c1-7-11-24-16-25-21(5)30-28-27(26-19(3)14-18(2)15-20(26)4)22(6)31-33(28)29(25)32(24)17-23-12-9-8-10-13-23/h8-10,12-16H,17H2,1-6H3 |
| InChIKey | COTLLGOMLNTEGR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|