C23H29ClN4 — CID 22249522
3-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene;hydrochloride (PubChem CID 22249522) has the molecular formula C23H29ClN4 and a molecular weight of 396.97 g/mol. Its IUPAC name is 3-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene;hydrochloride.
| Compound Name | 3-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene;hydrochloride |
|---|---|
| PubChem CID | 22249522 |
| Molecular Formula | C23H29ClN4 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 3-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene;hydrochloride |
| SMILES | CCCCn1ccc2c(C)nc3c(-c4c(C)cc(C)cc4C)c(C)nn3c21.Cl |
| InChI | InChI=1S/C23H28N4.ClH/c1-7-8-10-26-11-9-19-17(5)24-22-21(18(6)25-27(22)23(19)26)20-15(3)12-14(2)13-16(20)4;/h9,11-13H,7-8,10H2,1-6H3;1H |
| InChIKey | SFDNCFFNBDFMRN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |