C25H25N5O3 — CID 22258552
N-[4-(hydroxycarbamoyl)pyrrolidin-3-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide (PubChem CID 22258552) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[4-(hydroxycarbamoyl)pyrrolidin-3-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide.
| Compound Name | N-[4-(hydroxycarbamoyl)pyrrolidin-3-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 22258552 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[4-(hydroxycarbamoyl)pyrrolidin-3-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide |
| SMILES | Cc1cc(Cn2ccc3cc(C(=O)NC4CNCC4C(=O)NO)ccc32)c2ccccc2n1 |
| InChI | InChI=1S/C25H25N5O3/c1-15-10-18(19-4-2-3-5-21(19)27-15)14-30-9-8-16-11-17(6-7-23(16)30)24(31)28-22-13-26-12-20(22)25(32)29-33/h2-11,20,22,26,33H,12-14H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | BHRQYCSPMOHYNF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|