C16H13ClF3NO3 — CID 22261871
3-(6-chloro-2-pyridinyl)-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid (PubChem CID 22261871) has the molecular formula C16H13ClF3NO3 and a molecular weight of 359.73 g/mol. Its IUPAC name is 3-(6-chloro-2-pyridinyl)-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid.
| Compound Name | 3-(6-chloro-2-pyridinyl)-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid |
|---|---|
| PubChem CID | 22261871 |
| Molecular Formula | C16H13ClF3NO3 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 3-(6-chloro-2-pyridinyl)-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(C(F)(F)F)cc1)C(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C16H13ClF3NO3/c17-13-3-1-2-12(21-13)14(22)11(15(23)24)8-9-4-6-10(7-5-9)16(18,19)20/h1-7,11,14,22H,8H2,(H,23,24) |
| InChIKey | JQWNWZUUEHSATH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|