C18H14ClF4NO3 — CID 22262011
5-(3-chlorophenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22262011) has the molecular formula C18H14ClF4NO3 and a molecular weight of 403.76 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22262011 |
| Molecular Formula | C18H14ClF4NO3 |
| Molecular Weight | 403.76 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 5-(3-chlorophenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2cccc(OC(F)(F)C(F)F)c2)C(c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C18H14ClF4NO3/c19-12-5-2-4-11(9-12)15-14(24-17(25)26-15)8-10-3-1-6-13(7-10)27-18(22,23)16(20)21/h1-7,9,14-16H,8H2,(H,24,25) |
| InChIKey | XQRHHIVFQCKHAJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|