C17H24BrN5O3S — CID 22268929
[4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 22268929) has the molecular formula C17H24BrN5O3S and a molecular weight of 458.38 g/mol. Its IUPAC name is [4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 22268929 |
| Molecular Formula | C17H24BrN5O3S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CCCCSc1nc(Br)c2nnn(C3CC(CO)C4OC(C)(C)OC43)c2n1 |
| InChI | InChI=1S/C17H24BrN5O3S/c1-4-5-6-27-16-19-14(18)11-15(20-16)23(22-21-11)10-7-9(8-24)12-13(10)26-17(2,3)25-12/h9-10,12-13,24H,4-8H2,1-3H3 |
| InChIKey | HMGCZZOFYJVGGD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|