C17H26N6O3S — CID 22973214
[(3aS,4R,6R,6aR)-4-(7-amino-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 22973214) has the molecular formula C17H26N6O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-(7-amino-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-(7-amino-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 22973214 |
| Molecular Formula | C17H26N6O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-(7-amino-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CCCCSc1nc(N)c2nnn([C@@H]3C[C@H](CO)[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C17H26N6O3S/c1-4-5-6-27-16-19-14(18)11-15(20-16)23(22-21-11)10-7-9(8-24)12-13(10)26-17(2,3)25-12/h9-10,12-13,24H,4-8H2,1-3H3,(H2,18,19,20)/t9-,10-,12-,13+/m1/s1 |
| InChIKey | DJIOTJYSBQUZSX-WFFHOREQSA-N |
| XLogP | 1.77 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|