C13H16NO3- — CID 22284120
3-methyl-2-(phenacylamino)butanoate (PubChem CID 22284120) has the molecular formula C13H16NO3- and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-methyl-2-(phenacylamino)butanoate.
| Compound Name | 3-methyl-2-(phenacylamino)butanoate |
|---|---|
| PubChem CID | 22284120 |
| Molecular Formula | C13H16NO3- |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-methyl-2-(phenacylamino)butanoate |
| SMILES | CC(C)C(NCC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H17NO3/c1-9(2)12(13(16)17)14-8-11(15)10-6-4-3-5-7-10/h3-7,9,12,14H,8H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | SHFSZCVWTMTTOK-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |