C19H16F2N4O — CID 22291829
8-amino-1-(2,4-difluorophenyl)-5-methyl-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 22291829) has the molecular formula C19H16F2N4O and a molecular weight of 354.36 g/mol. Its IUPAC name is 8-amino-1-(2,4-difluorophenyl)-5-methyl-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-amino-1-(2,4-difluorophenyl)-5-methyl-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 22291829 |
| Molecular Formula | C19H16F2N4O |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 8-amino-1-(2,4-difluorophenyl)-5-methyl-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CC1Cc2c(C(N)=O)nn(-c3ccc(F)cc3F)c2-c2cc(N)ccc21 |
| InChI | InChI=1S/C19H16F2N4O/c1-9-6-14-17(19(23)26)24-25(16-5-2-10(20)7-15(16)21)18(14)13-8-11(22)3-4-12(9)13/h2-5,7-9H,6,22H2,1H3,(H2,23,26) |
| InChIKey | JHXDQNDEKRYTNN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|