C13H14FNO — CID 67741184
2-(6-fluoro-3-methyl-2,3-dihydroinden-1-ylidene)propanamide (PubChem CID 67741184) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-(6-fluoro-3-methyl-2,3-dihydroinden-1-ylidene)propanamide.
| Compound Name | 2-(6-fluoro-3-methyl-2,3-dihydroinden-1-ylidene)propanamide |
|---|---|
| PubChem CID | 67741184 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-(6-fluoro-3-methyl-2,3-dihydroinden-1-ylidene)propanamide |
| SMILES | CC(C(N)=O)=C1CC(C)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FNO/c1-7-5-11(8(2)13(15)16)12-6-9(14)3-4-10(7)12/h3-4,6-7H,5H2,1-2H3,(H2,15,16) |
| InChIKey | QOBKIKPZKBPCJN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|