C20H32O3 — CID 22297926
7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-2,3-diol (PubChem CID 22297926) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-2,3-diol.
| Compound Name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 22297926 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-2,3-diol |
| SMILES | C=CC1(C)CCC2=C(CCC3C2(C)CC(O)C(O)C3(C)CO)C1 |
| InChI | InChI=1S/C20H32O3/c1-5-18(2)9-8-14-13(10-18)6-7-16-19(14,3)11-15(22)17(23)20(16,4)12-21/h5,15-17,21-23H,1,6-12H2,2-4H3 |
| InChIKey | YQHFZHVDTYPXNE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|